Pigment gul 150-Corimax Gul 150
Technical parameters of Pigment yellow 150
| Farveindeks nr. | Pigment gul 150 |
| Produktnavn | Corimax Yellow 150 |
| Produktkategori | Organisk pigment |
| CAS-nummer | 68511-62-6/25157-64-6 |
| EU-nummer | 270-944-8 |
| Kemisk familie | Mono azo |
| Molekylær vægt | 282.17 |
| Molekylformel | C8H6N6O6 |
| PH-værdi | 7 |
| Massefylde | 2.0 |
| Olieabsorption (ml / 100 g)% | 55 |
| Let hurtighed (belægning) | 7-8 |
| Varmemodstand (belægning) | 200 |
| Lysstyrke (plast) | 7-8 |
| Varmemodstand (plast) | 280 |
| Vandafvisende | 5 |
| Oliebestandighed | 5 |
| Syrebestandighed | 4 |
| Alkali modstand | 4 |
Farve | ![]() |
| Nuancefordeling |
Features: Suitable for nylon
Molekylstruktur:

Names and Identifiers
Synonyms
- 68511-62-6
- Nickel 5,5'-azobis-2,4,6(1H,3H,5H)-pyrimidinetrionecomplexes
- 5,5'-Azobis[6-hydroxypyrimidine-2,4(1H,3H)-dione]
- SCHEMBL8408224
- SCHEMBL21941231
- (E)-5,5'-(diazene-1,2-diyl)bis(6-hydroxypyrimidine-2,4(1H,3H)-dione)
IUPAC Name: 6-hydroxy-5-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-1H-pyrimidine-2,4-dione
InChI: InChI=1S/C8H6N6O6/c15-3-1(4(16)10-7(19)9-3)13-14-2-5(17)11-8(20)12-6(2)18/h(H3,9,10,15,16,19)(H3,11,12,17,18,20)
InChIKey: KUKOUHRUVBQEFK-UHFFFAOYSA-N
Canonical SMILES: C1(=C(NC(=O)NC1=O)O)N=NC2=C(NC(=O)NC2=O)O
Other Identifiers
CAS: 68511-62-6
European Community (EC) Number: 270-944-8
Nikkaji Number: J2.917.432F
Chemical and Physical Properties
Computed Properties
| Property Name | Property Value |
| Molekylær vægt | 282.17 g/mol |
| XLogP3-AA | -2 |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 2 |
| Exact Mass | 282.03488193 g/mol |
| Monoisotopic Mass | 282.03488193 g/mol |
| Topological Polar Surface Area | 182Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 577 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Physical Description
Dry Powder; Dry Powder, Liquid; Water or Solvent Wet Solid
Ansøgning:
Anbefales til bilmaling, industriel maling, pulverbelægning, trykpasta, PVC, gummi, PS, PP, PE, PU, vandbaseret trykfarve, opløsningsmiddelfarve, UV blæk.
Kan bruges i arkitektoniske belægninger, coilbelægninger, offsetfarver.











